C23H26ClFN6O — CID 46293319
N-[N-(3-chloro-4-fluorophenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-(dimethylamino)benzamide (PubChem CID 46293319) has the molecular formula C23H26ClFN6O and a molecular weight of 456.95 g/mol. Its IUPAC name is N-[N-(3-chloro-4-fluorophenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-(dimethylamino)benzamide.
| Compound Name | N-[N-(3-chloro-4-fluorophenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 46293319 |
| Molecular Formula | C23H26ClFN6O |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[N-(3-chloro-4-fluorophenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-(dimethylamino)benzamide |
| SMILES | Cc1nn(C)c(C)c1C/N=C(\NC(=O)c1cccc(N(C)C)c1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClFN6O/c1-14-19(15(2)31(5)29-14)13-26-23(27-17-9-10-21(25)20(24)12-17)28-22(32)16-7-6-8-18(11-16)30(3)4/h6-12H,13H2,1-5H3,(H2,26,27,28,32) |
| InChIKey | QRJADGVARPAYMK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|