C23H25F2N5O — CID 46293558
N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 46293558) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 46293558 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | Cc1ccc(N/C(=N/Cc2c(C)nn(C)c2C)NC(=O)c2ccc(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C23H25F2N5O/c1-13-6-9-21(14(2)10-13)27-23(26-12-18-15(3)29-30(5)16(18)4)28-22(31)17-7-8-19(24)20(25)11-17/h6-11H,12H2,1-5H3,(H2,26,27,28,31) |
| InChIKey | ZSWSWRRWCMORCQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|