C24H28ClN5O — CID 46294581
4-chloro-N-[N-(2,4-dimethylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]benzamide (PubChem CID 46294581) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is 4-chloro-N-[N-(2,4-dimethylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(2,4-dimethylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46294581 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-chloro-N-[N-(2,4-dimethylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N/CCc2c(C)nn(C)c2C)NC(=O)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C24H28ClN5O/c1-15-6-11-22(16(2)14-15)27-24(28-23(31)19-7-9-20(25)10-8-19)26-13-12-21-17(3)29-30(5)18(21)4/h6-11,14H,12-13H2,1-5H3,(H2,26,27,28,31) |
| InChIKey | HAOQCNMFJCHSKV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|