C25H30ClN5O3 — CID 46294577
N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3,4-dimethoxybenzamide (PubChem CID 46294577) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 46294577 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=N\CCc2c(C)nn(C)c2C)Nc2cccc(Cl)c2C)cc1OC |
| InChI | InChI=1S/C25H30ClN5O3/c1-15-20(26)8-7-9-21(15)28-25(27-13-12-19-16(2)30-31(4)17(19)3)29-24(32)18-10-11-22(33-5)23(14-18)34-6/h7-11,14H,12-13H2,1-6H3,(H2,27,28,29,32) |
| InChIKey | RUSAJUAJHBDKEO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|