C23H25ClFN5O — CID 46294802
N-[N-(4-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-4-fluorobenzamide (PubChem CID 46294802) has the molecular formula C23H25ClFN5O and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[N-(4-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(4-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46294802 |
| Molecular Formula | C23H25ClFN5O |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[N-(4-chloro-2-methylphenyl)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]carbamimidoyl]-4-fluorobenzamide |
| SMILES | Cc1cc(Cl)ccc1N/C(=N/CCc1c(C)nn(C)c1C)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25ClFN5O/c1-14-13-18(24)7-10-21(14)27-23(28-22(31)17-5-8-19(25)9-6-17)26-12-11-20-15(2)29-30(4)16(20)3/h5-10,13H,11-12H2,1-4H3,(H2,26,27,28,31) |
| InChIKey | BTLDUQWYCVLUTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|