C26H32ClN5O — CID 46293355
4-tert-butyl-N-[N-(4-chloro-2-methylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293355) has the molecular formula C26H32ClN5O and a molecular weight of 466.03 g/mol. Its IUPAC name is 4-tert-butyl-N-[N-(4-chloro-2-methylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-tert-butyl-N-[N-(4-chloro-2-methylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293355 |
| Molecular Formula | C26H32ClN5O |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-tert-butyl-N-[N-(4-chloro-2-methylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | Cc1cc(Cl)ccc1N/C(=N/Cc1c(C)nn(C)c1C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32ClN5O/c1-16-14-21(27)12-13-23(16)29-25(28-15-22-17(2)31-32(7)18(22)3)30-24(33)19-8-10-20(11-9-19)26(4,5)6/h8-14H,15H2,1-7H3,(H2,28,29,30,33) |
| InChIKey | DNYNJDKOBZDMKS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|