C23H26ClN5O — CID 46293365
3-chloro-N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293365) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is 3-chloro-N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293365 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-chloro-N-[N-(2,4-dimethylphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N/Cc2c(C)nn(C)c2C)NC(=O)c2cccc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C23H26ClN5O/c1-14-9-10-21(15(2)11-14)26-23(25-13-20-16(3)28-29(5)17(20)4)27-22(30)18-7-6-8-19(24)12-18/h6-12H,13H2,1-5H3,(H2,25,26,27,30) |
| InChIKey | LKCDGASYCCRDIE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|