C23H23ClFN5O3 — CID 46293020
N-[N-(3-chloro-4-fluorophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46293020) has the molecular formula C23H23ClFN5O3 and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[N-(3-chloro-4-fluorophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[N-(3-chloro-4-fluorophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46293020 |
| Molecular Formula | C23H23ClFN5O3 |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[N-(3-chloro-4-fluorophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2ccc3c(c2)OCO3)Nc2ccc(F)c(Cl)c2)c1C |
| InChI | InChI=1S/C23H23ClFN5O3/c1-4-30-14(3)17(13(2)29-30)11-26-23(27-16-6-7-19(25)18(24)10-16)28-22(31)15-5-8-20-21(9-15)33-12-32-20/h5-10H,4,11-12H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | AHPKYSNCPSDRPE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|