C23H25BrFN5O — CID 46293217
N-[N-(3-bromophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluoro-4-methylbenzamide (PubChem CID 46293217) has the molecular formula C23H25BrFN5O and a molecular weight of 486.39 g/mol. Its IUPAC name is N-[N-(3-bromophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[N-(3-bromophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 46293217 |
| Molecular Formula | C23H25BrFN5O |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[N-(3-bromophenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2ccc(C)c(F)c2)Nc2cccc(Br)c2)c1C |
| InChI | InChI=1S/C23H25BrFN5O/c1-5-30-16(4)20(15(3)29-30)13-26-23(27-19-8-6-7-18(24)12-19)28-22(31)17-10-9-14(2)21(25)11-17/h6-12H,5,13H2,1-4H3,(H2,26,27,28,31) |
| InChIKey | ZNSWEKMPOGFLNY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|