C25H27F2N5O3 — CID 46293098
ethyl 4-[[N-(3,4-difluorobenzoyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]benzoate (PubChem CID 46293098) has the molecular formula C25H27F2N5O3 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 4-[[N-(3,4-difluorobenzoyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]benzoate.
| Compound Name | ethyl 4-[[N-(3,4-difluorobenzoyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 46293098 |
| Molecular Formula | C25H27F2N5O3 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | ethyl 4-[[N-(3,4-difluorobenzoyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N/C(=N/Cc2c(C)nn(CC)c2C)NC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C25H27F2N5O3/c1-5-32-16(4)20(15(3)31-32)14-28-25(30-23(33)18-9-12-21(26)22(27)13-18)29-19-10-7-17(8-11-19)24(34)35-6-2/h7-13H,5-6,14H2,1-4H3,(H2,28,29,30,33) |
| InChIKey | AEASNUCCTSOTLW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|