C25H31N5O2 — CID 46293121
N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)carbamimidoyl]-3,5-dimethylbenzamide (PubChem CID 46293121) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)carbamimidoyl]-3,5-dimethylbenzamide.
| Compound Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)carbamimidoyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 46293121 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(4-methoxyphenyl)carbamimidoyl]-3,5-dimethylbenzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2cc(C)cc(C)c2)Nc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C25H31N5O2/c1-7-30-19(5)23(18(4)29-30)15-26-25(27-21-8-10-22(32-6)11-9-21)28-24(31)20-13-16(2)12-17(3)14-20/h8-14H,7,15H2,1-6H3,(H2,26,27,28,31) |
| InChIKey | KAAJOLJPFQUVJH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|