C15H15F3N4O3 — CID 36580401
3,4-dimethoxy-5-prop-2-enyl-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide (PubChem CID 36580401) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is 3,4-dimethoxy-5-prop-2-enyl-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 3,4-dimethoxy-5-prop-2-enyl-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 36580401 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3,4-dimethoxy-5-prop-2-enyl-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide |
| SMILES | C=CCc1cc(C(=O)Nc2n[nH]c(C(F)(F)F)n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15F3N4O3/c1-4-5-8-6-9(7-10(24-2)11(8)25-3)12(23)19-14-20-13(21-22-14)15(16,17)18/h4,6-7H,1,5H2,2-3H3,(H2,19,20,21,22,23) |
| InChIKey | LSSPBXCMYBALMO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|