C17H19N3O4S — CID 17424042
N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 17424042) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 17424042 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2nc(CC(N)=O)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N3O4S/c1-4-5-10-6-11(7-13(23-2)15(10)24-3)16(22)20-17-19-12(9-25-17)8-14(18)21/h4,6-7,9H,1,5,8H2,2-3H3,(H2,18,21)(H,19,20,22) |
| InChIKey | MFDCKYGYFIAWFH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|