C18H21N3O6S2 — CID 2314297
ethyl 2-[2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 2314297) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is ethyl 2-[2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 2314297 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | ethyl 2-[2-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C18H21N3O6S2/c1-5-27-14(22)8-11-9-29-18(19-11)21-17(28)20-16(23)10-6-12(24-2)15(26-4)13(7-10)25-3/h6-7,9H,5,8H2,1-4H3,(H2,19,20,21,23,28) |
| InChIKey | NJVBVUUOAKXJQU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|