C17H18N2O5S — CID 18103816
methyl 2-[(3,4-dimethoxy-5-prop-2-enylbenzoyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 18103816) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-[(3,4-dimethoxy-5-prop-2-enylbenzoyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3,4-dimethoxy-5-prop-2-enylbenzoyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18103816 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[(3,4-dimethoxy-5-prop-2-enylbenzoyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | C=CCc1cc(C(=O)Nc2ncc(C(=O)OC)s2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N2O5S/c1-5-6-10-7-11(8-12(22-2)14(10)23-3)15(20)19-17-18-9-13(25-17)16(21)24-4/h5,7-9H,1,6H2,2-4H3,(H,18,19,20) |
| InChIKey | ZPKUJRGNYJUVMO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|