C16H18N2O6S — CID 155176323
ethyl 2-[(3,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 155176323) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is ethyl 2-[(3,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 155176323 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | ethyl 2-[(3,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)c2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C16H18N2O6S/c1-5-24-15(20)12-8-17-16(25-12)18-14(19)9-6-10(21-2)13(23-4)11(7-9)22-3/h6-8H,5H2,1-4H3,(H,17,18,19) |
| InChIKey | XCWUZTJWICAFRA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |