C14H15BrN2O3S — CID 4814407
3-bromo-4-ethoxy-5-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 4814407) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4814407 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCOc1c(Br)cc(C(=O)Nc2ncc(C)s2)cc1OC |
| InChI | InChI=1S/C14H15BrN2O3S/c1-4-20-12-10(15)5-9(6-11(12)19-3)13(18)17-14-16-7-8(2)21-14/h5-7H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | JEXQFSZOEKIZQO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |