C16H21N3O4S — CID 117092377
N-propyl-2-(3,4,5-trimethoxyanilino)-1,3-thiazole-5-carboxamide (PubChem CID 117092377) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-propyl-2-(3,4,5-trimethoxyanilino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-propyl-2-(3,4,5-trimethoxyanilino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117092377 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-propyl-2-(3,4,5-trimethoxyanilino)-1,3-thiazole-5-carboxamide |
| SMILES | CCCNC(=O)c1cnc(Nc2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C16H21N3O4S/c1-5-6-17-15(20)13-9-18-16(24-13)19-10-7-11(21-2)14(23-4)12(8-10)22-3/h7-9H,5-6H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | GWEBRGRORGHLDO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |