C17H16N4O2S — CID 117089144
N-(2-phenoxyethyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 117089144) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117089144 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(Nc2ccncc2)s1 |
| InChI | InChI=1S/C17H16N4O2S/c22-16(19-10-11-23-14-4-2-1-3-5-14)15-12-20-17(24-15)21-13-6-8-18-9-7-13/h1-9,12H,10-11H2,(H,19,22)(H,18,20,21) |
| InChIKey | UJJYVUWRCIKDQW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|