C18H23N3O3S — CID 117082676
2-[(4-hydroxycyclohexyl)amino]-N-(2-phenoxyethyl)-1,3-thiazole-5-carboxamide (PubChem CID 117082676) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-N-(2-phenoxyethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-N-(2-phenoxyethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117082676 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-N-(2-phenoxyethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(NC2CCC(O)CC2)s1 |
| InChI | InChI=1S/C18H23N3O3S/c22-14-8-6-13(7-9-14)21-18-20-12-16(25-18)17(23)19-10-11-24-15-4-2-1-3-5-15/h1-5,12-14,22H,6-11H2,(H,19,23)(H,20,21) |
| InChIKey | HHNAOVYKLVVMHD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|