C12H12N2O2S — CID 63049091
N-(2-phenoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 63049091) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63049091 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-(2-phenoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cscn1 |
| InChI | InChI=1S/C12H12N2O2S/c15-12(11-8-17-9-14-11)13-6-7-16-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,13,15) |
| InChIKey | PGBYACBLMIVBPF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|