C7H9N3O3S — CID 83205186
2-(1,3-thiazole-4-carbonylamino)ethyl carbamate (PubChem CID 83205186) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-(1,3-thiazole-4-carbonylamino)ethyl carbamate.
| Compound Name | 2-(1,3-thiazole-4-carbonylamino)ethyl carbamate |
|---|---|
| PubChem CID | 83205186 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-(1,3-thiazole-4-carbonylamino)ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1cscn1 |
| InChI | InChI=1S/C7H9N3O3S/c8-7(12)13-2-1-9-6(11)5-3-14-4-10-5/h3-4H,1-2H2,(H2,8,12)(H,9,11) |
| InChIKey | WOLJJOVYMXWAFO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|