C8H11BrN2O2S — CID 114309848
N-(2-bromo-3-methoxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 114309848) has the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 114309848 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCC(Br)CNC(=O)c1cscn1 |
| InChI | InChI=1S/C8H11BrN2O2S/c1-13-3-6(9)2-10-8(12)7-4-14-5-11-7/h4-6H,2-3H2,1H3,(H,10,12) |
| InChIKey | WSBHYSKMFQNLFM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|