C8H12N2O2S — CID 63038066
N-(1-methoxypropan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 63038066) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-methoxypropan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63038066 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COCC(C)NC(=O)c1cscn1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6(3-12-2)10-8(11)7-4-13-5-9-7/h4-6H,3H2,1-2H3,(H,10,11) |
| InChIKey | HOQKSTGBAJGFFJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |