C10H16N2OS — CID 63038589
N-(4-methylpentan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 63038589) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-(4-methylpentan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-methylpentan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63038589 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-(4-methylpentan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)c1cscn1 |
| InChI | InChI=1S/C10H16N2OS/c1-7(2)4-8(3)12-10(13)9-5-14-6-11-9/h5-8H,4H2,1-3H3,(H,12,13) |
| InChIKey | JASZKJCDMIKZNF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |