C9H14N2O2S — CID 66106843
N-(4-hydroxy-2-methylbutyl)-1,3-thiazole-4-carboxamide (PubChem CID 66106843) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylbutyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66106843 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | N-(4-hydroxy-2-methylbutyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(CCO)CNC(=O)c1cscn1 |
| InChI | InChI=1S/C9H14N2O2S/c1-7(2-3-12)4-10-9(13)8-5-14-6-11-8/h5-7,12H,2-4H2,1H3,(H,10,13) |
| InChIKey | MYZXMNNTWYPKET-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |