C10H18N2OS — CID 176555037
N-butyl-1,3-thiazole-4-carboxamide;ethane (PubChem CID 176555037) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is N-butyl-1,3-thiazole-4-carboxamide;ethane.
| Compound Name | N-butyl-1,3-thiazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 176555037 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-butyl-1,3-thiazole-4-carboxamide;ethane |
| SMILES | CC.CCCCNC(=O)c1cscn1 |
| InChI | InChI=1S/C8H12N2OS.C2H6/c1-2-3-4-9-8(11)7-5-12-6-10-7;1-2/h5-6H,2-4H2,1H3,(H,9,11);1-2H3 |
| InChIKey | FCFSRJHOMYKHOW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|