C7H11N3OS — CID 130734598
N'-ethyl-N'-methyl-1,3-thiazole-4-carbohydrazide (PubChem CID 130734598) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-ethyl-N'-methyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 130734598 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N'-ethyl-N'-methyl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCN(C)NC(=O)c1cscn1 |
| InChI | InChI=1S/C7H11N3OS/c1-3-10(2)9-7(11)6-4-12-5-8-6/h4-5H,3H2,1-2H3,(H,9,11) |
| InChIKey | DPYPRCOZTGTYMV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|