C4H6ClN3OS — CID 146013643
1,3-thiazole-4-carbohydrazide;hydrochloride (PubChem CID 146013643) has the molecular formula C4H6ClN3OS and a molecular weight of 179.63 g/mol. Its IUPAC name is 1,3-thiazole-4-carbohydrazide;hydrochloride.
| Compound Name | 1,3-thiazole-4-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 146013643 |
| Molecular Formula | C4H6ClN3OS |
| Molecular Weight | 179.63 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | 1,3-thiazole-4-carbohydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)c1cscn1 |
| InChI | InChI=1S/C4H5N3OS.ClH/c5-7-4(8)3-1-9-2-6-3;/h1-2H,5H2,(H,7,8);1H |
| InChIKey | LHAYAKZVXDYYLA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.63 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|