C7H10N4O2S — CID 76982242
N-(3-amino-3-hydroxyiminopropyl)-1,3-thiazole-4-carboxamide (PubChem CID 76982242) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 76982242 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(CCNC(=O)c1cscn1)=NO |
| InChI | InChI=1S/C7H10N4O2S/c8-6(11-13)1-2-9-7(12)5-3-14-4-10-5/h3-4,13H,1-2H2,(H2,8,11)(H,9,12) |
| InChIKey | NADPDFZQZFSLPW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|