C9H12N2O3S2 — CID 115731587
3-[2-(1,3-thiazole-4-carbonylamino)ethylsulfanyl]propanoic acid (PubChem CID 115731587) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[2-(1,3-thiazole-4-carbonylamino)ethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-(1,3-thiazole-4-carbonylamino)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 115731587 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-[2-(1,3-thiazole-4-carbonylamino)ethylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCNC(=O)c1cscn1 |
| InChI | InChI=1S/C9H12N2O3S2/c12-8(13)1-3-15-4-2-10-9(14)7-5-16-6-11-7/h5-6H,1-4H2,(H,10,14)(H,12,13) |
| InChIKey | IYNKLQBGIQABCA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|