C12H16N2OS — CID 62046502
N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 62046502) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62046502 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cscn1 |
| InChI | InChI=1S/C12H16N2OS/c15-12(11-8-16-9-14-11)13-7-6-10-4-2-1-3-5-10/h4,8-9H,1-3,5-7H2,(H,13,15) |
| InChIKey | HHSKDLJBBUHIEL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|