C15H24N2O3S — CID 84556786
11-(1,3-thiazole-4-carbonylamino)undecanoic acid (PubChem CID 84556786) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is 11-(1,3-thiazole-4-carbonylamino)undecanoic acid.
| Compound Name | 11-(1,3-thiazole-4-carbonylamino)undecanoic acid |
|---|---|
| PubChem CID | 84556786 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 11-(1,3-thiazole-4-carbonylamino)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCNC(=O)c1cscn1 |
| InChI | InChI=1S/C15H24N2O3S/c18-14(19)9-7-5-3-1-2-4-6-8-10-16-15(20)13-11-21-12-17-13/h11-12H,1-10H2,(H,16,20)(H,18,19) |
| InChIKey | WKLYAUAAAUYWSA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|