C8H11BrN2OS — CID 106845763
N-(4-bromobutyl)-1,3-thiazole-4-carboxamide (PubChem CID 106845763) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is N-(4-bromobutyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-bromobutyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 106845763 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | N-(4-bromobutyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCCBr)c1cscn1 |
| InChI | InChI=1S/C8H11BrN2OS/c9-3-1-2-4-10-8(12)7-5-13-6-11-7/h5-6H,1-4H2,(H,10,12) |
| InChIKey | TYERJQJHRJTGMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|