C13H13ClN2O3S2 — CID 63024069
4-[3-(1,3-thiazole-4-carbonylamino)propyl]benzenesulfonyl chloride (PubChem CID 63024069) has the molecular formula C13H13ClN2O3S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 4-[3-(1,3-thiazole-4-carbonylamino)propyl]benzenesulfonyl chloride.
| Compound Name | 4-[3-(1,3-thiazole-4-carbonylamino)propyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63024069 |
| Molecular Formula | C13H13ClN2O3S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-[3-(1,3-thiazole-4-carbonylamino)propyl]benzenesulfonyl chloride |
| SMILES | O=C(NCCCc1ccc(S(=O)(=O)Cl)cc1)c1cscn1 |
| InChI | InChI=1S/C13H13ClN2O3S2/c14-21(18,19)11-5-3-10(4-6-11)2-1-7-15-13(17)12-8-20-9-16-12/h3-6,8-9H,1-2,7H2,(H,15,17) |
| InChIKey | KHBKIIIQTLHFTE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|