C14H20ClNO3S — CID 60906391
4-[3-(2,2-dimethylpropanoylamino)propyl]benzenesulfonyl chloride (PubChem CID 60906391) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 4-[3-(2,2-dimethylpropanoylamino)propyl]benzenesulfonyl chloride.
| Compound Name | 4-[3-(2,2-dimethylpropanoylamino)propyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 60906391 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[3-(2,2-dimethylpropanoylamino)propyl]benzenesulfonyl chloride |
| SMILES | CC(C)(C)C(=O)NCCCc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-14(2,3)13(17)16-10-4-5-11-6-8-12(9-7-11)20(15,18)19/h6-9H,4-5,10H2,1-3H3,(H,16,17) |
| InChIKey | LGTHGJXHQHEVRX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|