C19H23NO3S — CID 155557565
2-(benzenesulfonyl)-2-methyl-N-(3-phenylpropyl)propanamide (PubChem CID 155557565) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-methyl-N-(3-phenylpropyl)propanamide.
| Compound Name | 2-(benzenesulfonyl)-2-methyl-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 155557565 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(benzenesulfonyl)-2-methyl-N-(3-phenylpropyl)propanamide |
| SMILES | CC(C)(C(=O)NCCCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3S/c1-19(2,24(22,23)17-13-7-4-8-14-17)18(21)20-15-9-12-16-10-5-3-6-11-16/h3-8,10-11,13-14H,9,12,15H2,1-2H3,(H,20,21) |
| InChIKey | ZRTWTRZAPGYULL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|