C14H20F2N2O — CID 166390711
3-(dimethylamino)-2,2-difluoro-N-(3-phenylpropyl)propanamide (PubChem CID 166390711) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-(dimethylamino)-2,2-difluoro-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-(dimethylamino)-2,2-difluoro-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 166390711 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-(dimethylamino)-2,2-difluoro-N-(3-phenylpropyl)propanamide |
| SMILES | CN(C)CC(F)(F)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C14H20F2N2O/c1-18(2)11-14(15,16)13(19)17-10-6-9-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3,(H,17,19) |
| InChIKey | FXOTYOYICGRLOX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|