3-phenylpropylurea;2,2,2-trifluoroacetic acid

C12H15F3N2O3 — CID 162337981

IUPAC3-phenylpropylurea;2,2,2-trifluoroacetic acid
SMILESNC(=O)NCCCc1ccccc1.O=C(O)C(F)(F)F
InChIInChI=1S/C10H14N2O.C2HF3O2/c11-10(13)12-8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-6H,4,7-8H2,(H3,11,12,13);(H,6,7)
InChIKeySUPZGYCOFFVGCA-UHFFFAOYSA-N
MW292.26 g/mol
LogP1.92
Rot. Bonds4

About 3-phenylpropylurea;2,2,2-trifluoroacetic acid

3-phenylpropylurea;2,2,2-trifluoroacetic acid (PubChem CID 162337981) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-phenylpropylurea;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-phenylpropylurea;2,2,2-trifluoroacetic acid
PubChem CID162337981
Molecular FormulaC12H15F3N2O3
Molecular Weight292.26 g/mol
Exact Mass292.10
IUPAC Name3-phenylpropylurea;2,2,2-trifluoroacetic acid
SMILESNC(=O)NCCCc1ccccc1.O=C(O)C(F)(F)F
InChIInChI=1S/C10H14N2O.C2HF3O2/c11-10(13)12-8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-6H,4,7-8H2,(H3,11,12,13);(H,6,7)
InChIKeySUPZGYCOFFVGCA-UHFFFAOYSA-N
XLogP1.92
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.26
LogP ≤ 51.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-phenylpropylurea;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenylpropylurea;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-phenylpropylurea;2,2,2-trifluoroacetic acid (CID 162337981) is 3-phenylpropylurea;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-phenylpropylurea;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-phenylpropylurea;2,2,2-trifluoroacetic acid is NC(=O)NCCCc1ccccc1.O=C(O)C(F)(F)F.
What is the InChIKey of 3-phenylpropylurea;2,2,2-trifluoroacetic acid?
The InChIKey is SUPZGYCOFFVGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.C2HF3O2/c11-10(13)12-8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-6H,4,7-8H2,(H3,11,12,13);(H,6,7).
What are the key properties of 3-phenylpropylurea;2,2,2-trifluoroacetic acid?
3-phenylpropylurea;2,2,2-trifluoroacetic acid has a molecular weight of 292.26 g/mol, XLogP of 1.92, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropylurea;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 162337981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).