C12H15F3N2O3 — CID 162337981
3-phenylpropylurea;2,2,2-trifluoroacetic acid (PubChem CID 162337981) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-phenylpropylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-phenylpropylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162337981 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-phenylpropylurea;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)NCCCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O.C2HF3O2/c11-10(13)12-8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-6H,4,7-8H2,(H3,11,12,13);(H,6,7) |
| InChIKey | SUPZGYCOFFVGCA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|