C27H37F3N4O4 — CID 157301993
(2S)-6-amino-2-[(2-aminoacetyl)-(2-phenylethyl)amino]-N-(3-phenylpropyl)hexanamide;2,2,2-trifluoroacetic acid (PubChem CID 157301993) has the molecular formula C27H37F3N4O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-aminoacetyl)-(2-phenylethyl)amino]-N-(3-phenylpropyl)hexanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-6-amino-2-[(2-aminoacetyl)-(2-phenylethyl)amino]-N-(3-phenylpropyl)hexanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157301993 |
| Molecular Formula | C27H37F3N4O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (2S)-6-amino-2-[(2-aminoacetyl)-(2-phenylethyl)amino]-N-(3-phenylpropyl)hexanamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC[C@@H](C(=O)NCCCc1ccccc1)N(CCc1ccccc1)C(=O)CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H36N4O2.C2HF3O2/c26-17-8-7-15-23(25(31)28-18-9-14-21-10-3-1-4-11-21)29(24(30)20-27)19-16-22-12-5-2-6-13-22;3-2(4,5)1(6)7/h1-6,10-13,23H,7-9,14-20,26-27H2,(H,28,31);(H,6,7)/t23-;/m0./s1 |
| InChIKey | BBZXKLZMFPJHFQ-BQAIUKQQSA-N |
| XLogP | 2.90 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|