C27H39N3O3 — CID 86757003
tert-butyl N-[(4S)-4-[benzyl(methyl)amino]-5-oxo-5-(3-phenylpropylamino)pentyl]carbamate (PubChem CID 86757003) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-[benzyl(methyl)amino]-5-oxo-5-(3-phenylpropylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-[benzyl(methyl)amino]-5-oxo-5-(3-phenylpropylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 86757003 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | tert-butyl N-[(4S)-4-[benzyl(methyl)amino]-5-oxo-5-(3-phenylpropylamino)pentyl]carbamate |
| SMILES | CN(Cc1ccccc1)[C@@H](CCCNC(=O)OC(C)(C)C)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C27H39N3O3/c1-27(2,3)33-26(32)29-20-12-18-24(30(4)21-23-15-9-6-10-16-23)25(31)28-19-11-17-22-13-7-5-8-14-22/h5-10,13-16,24H,11-12,17-21H2,1-4H3,(H,28,31)(H,29,32)/t24-/m0/s1 |
| InChIKey | VVLRZARYXQJDFZ-DEOSSOPVSA-N |
| XLogP | 4.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|