C26H38N2O2 — CID 130376707
tert-butyl N-[3-[[4-phenyl-2-(2-phenylethyl)butyl]amino]propyl]carbamate (PubChem CID 130376707) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-phenyl-2-(2-phenylethyl)butyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-phenyl-2-(2-phenylethyl)butyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 130376707 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | tert-butyl N-[3-[[4-phenyl-2-(2-phenylethyl)butyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C26H38N2O2/c1-26(2,3)30-25(29)28-20-10-19-27-21-24(17-15-22-11-6-4-7-12-22)18-16-23-13-8-5-9-14-23/h4-9,11-14,24,27H,10,15-21H2,1-3H3,(H,28,29) |
| InChIKey | ICFOCVNPXNXHNL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|