C18H29N3O3 — CID 108864351
tert-butyl N-[2-[[benzyl(propan-2-yl)carbamoyl]amino]ethyl]carbamate (PubChem CID 108864351) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[benzyl(propan-2-yl)carbamoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[benzyl(propan-2-yl)carbamoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108864351 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl N-[2-[[benzyl(propan-2-yl)carbamoyl]amino]ethyl]carbamate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N3O3/c1-14(2)21(13-15-9-7-6-8-10-15)16(22)19-11-12-20-17(23)24-18(3,4)5/h6-10,14H,11-13H2,1-5H3,(H,19,22)(H,20,23) |
| InChIKey | JHLFIRQXKHINQZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|