C18H28N2O5 — CID 67188552
benzyl-[(2S)-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamic acid (PubChem CID 67188552) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is benzyl-[(2S)-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamic acid.
| Compound Name | benzyl-[(2S)-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67188552 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | benzyl-[(2S)-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CO)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28N2O5/c1-18(2,3)25-16(22)19-11-7-10-15(13-21)20(17(23)24)12-14-8-5-4-6-9-14/h4-6,8-9,15,21H,7,10-13H2,1-3H3,(H,19,22)(H,23,24)/t15-/m0/s1 |
| InChIKey | ZMWQPYPUTUYGLE-HNNXBMFYSA-N |
| XLogP | 2.83 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|