C19H33N3O — CID 20662234
(2S)-5-amino-2-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide (PubChem CID 20662234) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is (2S)-5-amino-2-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide.
| Compound Name | (2S)-5-amino-2-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide |
|---|---|
| PubChem CID | 20662234 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (2S)-5-amino-2-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide |
| SMILES | CC(C)CCN[C@@H](CCCN)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H33N3O/c1-16(2)12-15-21-18(11-6-13-20)19(23)22-14-7-10-17-8-4-3-5-9-17/h3-5,8-9,16,18,21H,6-7,10-15,20H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | UMQOCYDRDXPLAF-SFHVURJKSA-N |
| XLogP | 2.48 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|