C21H36N4O2 — CID 67564964
(2S)-2-[(2-aminoacetyl)amino]-5-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide (PubChem CID 67564964) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-5-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-5-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide |
|---|---|
| PubChem CID | 67564964 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-5-(3-methylbutylamino)-N-(3-phenylpropyl)pentanamide |
| SMILES | CC(C)CCNCCC[C@H](NC(=O)CN)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H36N4O2/c1-17(2)12-15-23-13-7-11-19(25-20(26)16-22)21(27)24-14-6-10-18-8-4-3-5-9-18/h3-5,8-9,17,19,23H,6-7,10-16,22H2,1-2H3,(H,24,27)(H,25,26)/t19-/m0/s1 |
| InChIKey | KVMTXTGQPVAIQB-IBGZPJMESA-N |
| XLogP | 1.59 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|