C17H26N2O2 — CID 108951176
N'-(3-methylbutyl)-N-(3-phenylpropyl)propanediamide (PubChem CID 108951176) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N'-(3-methylbutyl)-N-(3-phenylpropyl)propanediamide.
| Compound Name | N'-(3-methylbutyl)-N-(3-phenylpropyl)propanediamide |
|---|---|
| PubChem CID | 108951176 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N'-(3-methylbutyl)-N-(3-phenylpropyl)propanediamide |
| SMILES | CC(C)CCNC(=O)CC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-14(2)10-12-19-17(21)13-16(20)18-11-6-9-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | VFMPVGLRUYJSHF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|