C15H24N4O5 — CID 23208419
2-amino-5-(carbamoylamino)pentanoic acid;2-amino-3-phenylpropanoic acid (PubChem CID 23208419) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-amino-5-(carbamoylamino)pentanoic acid;2-amino-3-phenylpropanoic acid.
| Compound Name | 2-amino-5-(carbamoylamino)pentanoic acid;2-amino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 23208419 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-amino-5-(carbamoylamino)pentanoic acid;2-amino-3-phenylpropanoic acid |
| SMILES | NC(=O)NCCCC(N)C(=O)O.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H13N3O3/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4(5(10)11)2-1-3-9-6(8)12/h1-5,8H,6,10H2,(H,11,12);4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
| InChIKey | BEAZHIRKGOROPE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|