C6H14ClN3O3 — CID 72941546
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;hydrochloride (PubChem CID 72941546) has the molecular formula C6H14ClN3O3 and a molecular weight of 211.65 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 72941546 |
| Molecular Formula | C6H14ClN3O3 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;hydrochloride |
| SMILES | Cl.NC(=O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3.ClH/c7-4(5(10)11)2-1-3-9-6(8)12;/h4H,1-3,7H2,(H,10,11)(H3,8,9,12);1H/t4-;/m0./s1 |
| InChIKey | RSQCFPZQHNPAAZ-WCCKRBBISA-N |
| XLogP | -0.73 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|