C17H39N9O7 — CID 122669620
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2,5-diaminopentanoic acid (PubChem CID 122669620) has the molecular formula C17H39N9O7 and a molecular weight of 481.56 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2,5-diaminopentanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 122669620 |
| Molecular Formula | C17H39N9O7 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2,5-diaminopentanoic acid |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O.NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C6H13N3O3.C5H12N2O2/c7-4(5(11)12)2-1-3-10-6(8)9;7-4(5(10)11)2-1-3-9-6(8)12;6-3-1-2-4(7)5(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);4H,1-3,7H2,(H,10,11)(H3,8,9,12);4H,1-3,6-7H2,(H,8,9)/t3*4-/m000/s1 |
| InChIKey | PAUPHOMRDKVPFG-MOBQZEGBSA-N |
| XLogP | -3.56 |
| TPSA | 335.50 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|